| Class: | Dopamine β-hydroxylase inhibitor |
| Cas Number: | 1080028-80-3 |
| Pubchem: | 25052630 |
| Drugbank: | DB12389 |
| Chemspiderid: | 32701723 |
| Unii: | YLU32D0DNV |
| Chembl: | 4594440 |
| Synonyms: | BIA-5-1058; BIA 5-1058 |
| Iupac Name: | 4-[2-(benzylamino)ethyl]-3-[(3''R'')-6,8-difluoro-3,4-dihydro-2''H''-chromen-3-yl]-1H-imidazole-2-thione |
| C: | 21 |
| H: | 21 |
| F: | 2 |
| N: | 3 |
| O: | 1 |
| S: | 1 |
| Smiles: | C1[C@H](COC2=C1C=C(C=C2F)F)N3C(=CNC3=S)CCNCC4=CC=CC=C4 |
| Stdinchi: | 1S/C21H21F2N3OS/c22-16-8-15-9-18(13-27-20(15)19(23)10-16)26-17(12-25-21(26)28)6-7-24-11-14-4-2-1-3-5-14/h1-5,8,10,12,18,24H,6-7,9,11,13H2,(H,25,28)/t18-/m1/s1 |
| Stdinchikey: | ZSSLCFLHEFXANG-GOSISDBHSA-N |
Zamicastat (; developmental code name BIA-5-1058) is a peripherally selective dopamine β-hydroxylase (DBH) inhibitor which is under development for the treatment of pulmonary arterial hypertension (PAH) and heart failure.[1] It is structurally related to etamicastat and is said to be an improved version of this drug.[2] As of July 2022, zamicastat is in phase 2 clinical trials for PAH and phase 1 clinical trials for heart failure. However, no recent development has been reported for heart failure.