| Width: | 250px |
| Cas Number: | 90-86-8 |
| Pubchem: | 5370611 |
| Chemspiderid: | 4521391 |
| Unii: | Y1245J8012 |
| Kegg: | D03510 |
| Chembl: | 2104503 |
| Synonyms: | Cinnamylephedrine; N-Cinnamylephedrine |
| Iupac Name: | 2-[methyl-[(''E'')-3-phenylprop-2-enyl]amino]-1-phenylpropan-1-ol |
| C: | 19 |
| H: | 23 |
| N: | 1 |
| O: | 1 |
| Smiles: | CC(C(C1=CC=CC=C1)O)N(C)C/C=C/C2=CC=CC=C2 |
| Stdinchi: | 1S/C19H23NO/c1-16(19(21)18-13-7-4-8-14-18)20(2)15-9-12-17-10-5-3-6-11-17/h3-14,16,19,21H,15H2,1-2H3/b12-9+ |
| Stdinchikey: | YMJMZFPZRVMNCH-FMIVXFBMSA-N |
Cinnamedrine, also known as N-cinnamylephedrine, is a sympathomimetic drug with similar effects relative to those of ephedrine.[1] [2] It also has some local anesthetic activity. Cinnamedrine was previously used, in combination with analgesics, as an antispasmodic to treat dysmenorrhea in the over-the-counter drug Midol in the 1980s.[3] There is a case series of the drug being abused as a psychostimulant.[4]