| Cas Number: | 79594-24-4 |
| Pubchem: | 50234 |
| Chemspiderid: | 45554 |
| Unii: | 02WMX1FS9Y |
| Chembl: | 2111145 |
| Synonyms: | PR 741-976; a,a-Dimethyl-1-adamantaneethylamine; [2-(1-Adamantyl)-1,1-dimethylethyl]amine |
| Iupac Name: | 1-(1-adamantyl)-2-methylpropan-2-amine |
| C: | 14 |
| H: | 25 |
| N: | 1 |
| Smiles: | CC(C)(CC12CC3CC(C1)CC(C3)C2)N |
| Stdinchi: | 1S/C14H25N/c1-13(2,15)9-14-6-10-3-11(7-14)5-12(4-10)8-14/h10-12H,3-9,15H2,1-2H3 |
| Stdinchikey: | OWKXRDQRMTVCEX-UHFFFAOYSA-N |
Somantadine (; developmental code name PR 741-976), or somantadine hydrochloride in the case of the hydrochloride salt, is an experimental antiviral drug of the adamantane family related to amantadine and rimantadine that was never marketed.[1] [2] [3] It was first described by 1978.