| Legal Status: | Investigational |
| Cas Number: | 1262873-06-2 |
| Pubchem: | 50902259 |
| Iuphar Ligand: | 9875 |
| Drugbank: | DB12043 |
| Chemspiderid: | 32698273 |
| Unii: | 79O7855J4G |
| Chembl: | 4297633 |
| Synonyms: | STN-1012600 |
| Iupac Name: | propan-2-yl 4-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-4-(2,5-difluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoate |
| C: | 26 |
| H: | 36 |
| F: | 2 |
| O: | 6 |
| Smiles: | CC(C)OC(=O)CCC[C@H]1CC[C@H]2[C@H](C[C@H]([C@@H]2/C=C/[C@H](COC3=C(C=CC(=C3)F)F)O)O)OC1 |
| Stdinchi: | 1S/C26H36F2O6/c1-16(2)34-26(31)5-3-4-17-6-9-21-20(23(30)13-24(21)32-14-17)10-8-19(29)15-33-25-12-18(27)7-11-22(25)28/h7-8,10-12,16-17,19-21,23-24,29-30H,3-6,9,13-15H2,1-2H3/b10-8+/t17-,19+,20+,21+,23+,24-/m0/s1 |
| Stdinchikey: | BKVUSNOUTQMSBE-XCMGCKIWSA-N |
Sepetaprost is an investigational new drug that is being evaluated for the treatment of open angle glaucoma and ocular hypertension.[1] It is an agonist of the prostaglandin EP3 and F receptors.[2]