| Width: | 135px |
| Cas Number: | 213178-69-9 |
| Pubchem: | 10824736 |
| Chemspiderid: | 9000036 |
| Synonyms: | p-Cl-Phenylpiracetam; para-Chlorophenylpiracetam; 4-Chlorophenylpiracetam |
| Iupac Name: | 2-[4-(4-chlorophenyl)-2-oxopyrrolidin-1-yl]acetamide |
| C: | 12 |
| H: | 13 |
| Cl: | 1 |
| N: | 2 |
| O: | 2 |
| Smiles: | C1C(CN(C1=O)CC(=O)N)C2=CC=C(C=C2)Cl |
| Stdinchi: | 1S/C12H13ClN2O2/c13-10-3-1-8(2-4-10)9-5-12(17)15(6-9)7-11(14)16/h1-4,9H,5-7H2,(H2,14,16) |
| Stdinchikey: | NEEZTPLBDJRDCV-UHFFFAOYSA-N |
RGPU-95, also known as p-chlorophenylpiracetam, is a racetam and a derivative of phenylpiracetam.[1] [2] [3] It was developed by Russian researchers as a potential antidepressant and anxiolytic agent and was first described in the scientific literature by 2010. The drug is described as 5 to 10times more potent in its activity than phenylpiracetam in animals. It has been identified as a novel psychoactive drug and nootropic sold on the Internet.