Iupac Name: | Dimethyl N,N-(1,4(1,4)-dibenzenacyclohexaphane- 12,42-diylbis)biscarbamate| image = Odalasvir structure.svg| width = 300| alt =| caption = | tradename =| Drugs.com =| MedlinePlus =| pregnancy_AU = | pregnancy_US = | pregnancy_category =| legal_AU = | legal_CA = | legal_UK = | legal_US = Investigational New Drug| legal_status =| routes_of_administration = | bioavailability =| protein_bound =| metabolism =| elimination_half-life =| excretion = | CAS_number_Ref = | CAS_number = 1415119-52-6| UNII_Ref = | UNII = OVR52K7BDW| ATCvet =| ATC_prefix =| ATC_suffix =| PubChem = 71474517| DrugBank =| ChemSpiderID = 34500837| ChEMBL = | chemical_formula =| C=60 | H=72 | N=8 | O=6| StdInChIKey = LSYBRGMTRKJATA-IVEWBXRVSA-N| StdInChI = 1S/C60H72N8O6/c1-33(2)53(65-59(71)73-5)57(69)67-49-13-9-7-11-41(49)31-51(67)55-61-45-25-23-39(29-47(45)63-55)43-27-35-15-19-37(43)21-17-36-16-20-38(22-18-35)44(28-36)40-24-26-46-48(30-40)64-56(62-46)52-32-42-12-8-10-14-50(42)68(52)58(70)54(34(3)4)66-60(72)74-6/h15-16,19-20,23-30,33-34,41-42,49-54H,7-14,17-18,21-22,31-32H2,1-6H3,(H,61,63)(H,62,64)(H,65,71)(H,66,72)/t41-,42-,49-,50-,51-,52-,53-,54-/m0/s1| smiles = CC(C)[C@@H](C(=O)N1[C@H]2CCCC[C@H]2C[C@H]1C3=NC4=C(N3)C=C(C=C4)C5=C6CCC7=CC(=C(CCC(=C5)C=C6)C=C7)C8=CC9=C(C=C8)N=C(N9)[C@@H]1C[C@@H]2CCCC[C@@H]2N1C(=O)[C@H](C(C)C)NC(=O)OC)NC(=O)OC}} Odalasvir (INN,[1] previously known as ACH-3102)[2] [3] is an investigational new drug in development for the treatment of hepatitis C.[4] It is an NS5A inhibitor.[5] The NS5A protein serves multiple functions at various stages of the viral life cycle, including viral replication. NS5A also plays a role in the development of interferon-resistance, a common cause of treatment failure.[6] [7] [8] It is under development by Achillion Pharmaceuticals. See alsoReferences} |