| Cas Number: | 4757-49-7 |
| Pubchem: | 145765 |
| Chemspiderid: | 128589 |
| Unii: | 3FDC82890Y |
| Chembl: | 2104752 |
| Synonyms: | Desmethyldimetacrine; Nordimetacrine; N-Desmethyldimetacrine; SD-735; NSC-100296 |
| Iupac Name: | 3-(9,9-dimethylacridin-10-yl)-N-methylpropan-1-amine |
| C: | 19 |
| H: | 24 |
| N: | 2 |
| Smiles: | CC1(C2=CC=CC=C2N(C3=CC=CC=C31)CCCNC)C |
| Stdinchi: | 1S/C19H24N2/c1-19(2)15-9-4-6-11-17(15)21(14-8-13-20-3)18-12-7-5-10-16(18)19/h4-7,9-12,20H,8,13-14H2,1-3H3 |
| Stdinchikey: | PGSOFANFWNSSRA-UHFFFAOYSA-N |
Monometacrine (; developmental code name SD-735), also known as desmethyldimetacrine, is a drug of the tricyclic family described as an antidepressant which was never marketed.[1] [2] [3] It was first described in the literature by 1966. The drug is the N-desmethyl analogue of dimetacrine and is a metabolite of dimetacrine.