| Tradename: | Vyzulta |
| Dailymedid: | Latanoprostene bunod |
| Class: | Prostaglandin analog |
| Atc Prefix: | S01 |
| Atc Suffix: | EE06 |
| Legal Ca: | Rx-only |
| Legal Ca Comment: | [1] |
| Legal Us: | Rx-only |
| Legal Us Comment: | [2] |
| Cas Number: | 860005-21-6 |
| Pubchem: | 11156438 |
| Drugbank: | DB11660 |
| Chemspiderid: | 9331546 |
| Unii: | I6393O0922 |
| Kegg: | D10441 |
| Chembl: | 2364612 |
| Synonyms: | BOL-303259-X |
| Iupac Name: | 4-Nitrooxybutyl (Z)-7-[(1''R'',2''R'',3''R'',5''S'')-3,5-dihydroxy-2-[(3''R'')-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| C: | 27 |
| H: | 41 |
| N: | 1 |
| O: | 8 |
| Smiles: | C1[C@H]([C@@H]([C@H]([C@H]1O)C/C=C\CCCC(=O)OCCCCO[N+](=O)[O-])CC[C@H](CCC2=CC=CC=C2)O)O |
| Stdinchi: | 1S/C27H41NO8/c29-22(15-14-21-10-4-3-5-11-21)16-17-24-23(25(30)20-26(24)31)12-6-1-2-7-13-27(32)35-18-8-9-19-36-28(33)34/h1,3-6,10-11,22-26,29-31H,2,7-9,12-20H2/b6-1-/t22-,23+,24+,25-,26+/m0/s1 |
| Stdinchikey: | LOVMMUBRQUFEAH-UIEAZXIASA-N |
Latanoprostene bunod, sold under the brand name Vyzulta, is an ophthalmic medication used for the reduction of intraocular pressure in people with open-angle glaucoma or ocular hypertension.[3] It targets the trabecular meshwork directly. It is a prostaglandin analog.
The most common side effects include conjunctival (eye) redness, eye irritation, and eye discomfort (pain). Latanoprostene bunod may cause the iris (colored part of the eye) to become darker in color.
Latanoprostene bunod was approved for medical use in the United States in November 2017.[4] [5]
Latanoprostene bunod is indicated for the reduction of intraocular pressure in people with open-angle glaucoma or ocular hypertension.
The US Food and Drug Administration (FDA) approved latanoprostene bunod based on evidence from two clinical trials that enrolled 840 participants with open angle glaucoma or ocular hypertension. The trials evaluated the benefits and side effects of latanoprostene bunod. In each trial, participants were randomly assigned to receive either latanoprostene bunod or an approved drug timolol (ophthalmic solution) every day for three months. Neither the participants nor the health care providers knew which treatment was being given until after the trials were completed. The trials were conducted in the United States, the United Kingdom, Germany, Italy, Bulgaria, the Czech Republic, and Japan.