| Tradename: | Imeron, others |
| Routes Of Administration: | Intravenous, intra-arterial |
| Atc Prefix: | V08 |
| Atc Suffix: | AB10 |
| Legal Us: | Rx-only |
| Legal Us Comment: | [1] |
| Legal Status: | Rx-only |
| Metabolism: | none |
| Elimination Half-Life: | 109±20 min |
| Excretion: | Kidney |
| Cas Number: | 78649-41-9 |
| Pubchem: | 3731 |
| Drugbank: | DB11705 |
| Chemspiderid: | 3600 |
| Unii: | 17E17JBP8L |
| Kegg: | D01719 |
| Chebi: | 31710 |
| Iupac Name: | 1-N,3-N-bis(2,3-dihydroxypropyl)-5-(2-hydroxy-N-methylacetamido)-2,4,6-triiodobenzene-1,3-dicarboxamide |
| C: | 17 |
| H: | 22 |
| I: | 3 |
| N: | 3 |
| O: | 8 |
| Smiles: | Ic1c(c(I)c(c(I)c1N(C(=O)CO)C)C(=O)NCC(O)CO)C(=O)NCC(O)CO |
| Stdinchi: | 1S/C17H22I3N3O8/c1-23(9(29)6-26)15-13(19)10(16(30)21-2-7(27)4-24)12(18)11(14(15)20)17(31)22-3-8(28)5-25/h7-8,24-28H,2-6H2,1H3,(H,21,30)(H,22,31) |
| Stdinchikey: | NJKDOADNQSYQEV-UHFFFAOYSA-N |
Iomeprol, sold under the brand name Imeron among others, is a medication used as a radiocontrast agent in X-ray imaging.[2] [3]
It is classified as a water-soluble, nephrotrophic, low osmolar X-ray contrast medium. Low osmolar non-ionic agents are better tolerated and less likely to cause side effects than the high osmolar ionic agents.
The substance is not metabolized in the human body but excreted in unchanged form. It is decomposed slowly and can therefore accumulate in the environment.[4]
Iomeprol was approved for medical use in the United States in November 2024.[5]