| Iupac Name: | [(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl] acetate |
| Width: | 240 |
| Unii: | FA3U4A4VSR |
| Pubchem: | 165412103 |
| C: | 23 |
| H: | 34 |
| O: | 3 |
| Smiles: | CCCCCC1=CC2=C([C@@H]3CC(CC[C@H]3C(O2)(C)C)C)C(=C1)OC(=O)C |
| Stdinchi: | 1S/C23H34O3/c1-6-7-8-9-17-13-20(25-16(3)24)22-18-12-15(2)10-11-19(18)23(4,5)26-21(22)14-17/h13-15,18-19H,6-12H2,1-5H3/t15?,18-,19-/m1/s1 |
| Stdinchikey: | ZAZIHGFBNRVMAI-JCNKGUCWSA-N |
HHC-acetate (Hexahydrocannabinol-O-acetate, HHC-O) is a semi-synthetic cannabinoid derivative which has been marketed since around 2022.[1] [2] It is believed to be made in a three step process from cannabidiol extracted from hemp.[3] The legal status of hexahydrocannabinol and derivatives such as HHC-O varies between countries leading to widespread sale in some jurisdictions in Europe and the US, but in France HHC and HHC-O were banned in 2023, and HHC is already banned in several other countries.[4] On 1st of March 2024 HHC was banned on Czech Republic.[5]