| Width: | 150px |
| Cas Number: | 4774-53-2 |
| Pubchem: | 71202 |
| Chemspiderid: | 64338 |
| Unii: | 032WJR708Q |
| Chembl: | 2106109 |
| Synonyms: | Mo 876; DMA |
| Iupac Name: | S-[2-(dimethylamino)ethyl] 9,9-dimethylacridine-10-carbothioate |
| C: | 20 |
| H: | 24 |
| N: | 2 |
| O: | 1 |
| S: | 1 |
| Smiles: | CC1(C2=CC=CC=C2N(C3=CC=CC=C31)C(=O)SCCN(C)C)C |
| Stdinchi: | 1S/C20H24N2OS/c1-20(2)15-9-5-7-11-17(15)22(18-12-8-6-10-16(18)20)19(23)24-14-13-21(3)4/h5-12H,13-14H2,1-4H3 |
| Stdinchikey: | QXRUCDDVUMKOPI-UHFFFAOYSA-N |
Botiacrine (; developmental code name Mo 876) is a drug of the tricyclic family described as an antiparkinsonian agent which was either never marketed or was possibly marketed outside of the United States.[1] [2] [3] [4] [5] It was first described in the literature by 1965. The drug is an acridine derivative and is structurally related to the tricyclic antidepressant dimetacrine.