| Drug Name: | 5,6-MDO-MiPT |
| Cas Number: | 88048-28-6 |
| Unii: | 3F47P2Y9LC |
| Pubchem: | 13140997 |
| Chemspiderid: | 10524355 |
| Synonyms: | 5,6-methylenedioxy-N-methyl-N-isopropyltryptamine |
| Iupac Name: | N-[2-(5H-[1,3]dioxolo[4,5-f]indol-7-yl)ethyl]-N-methylpropan-2-amine |
| C: | 15 |
| H: | 20 |
| N: | 2 |
| O: | 2 |
| Smiles: | CC(C)N(C)CCC1=CNC2=CC3=C(C=C21)OCO3 |
| Stdinchi: | 1S/C15H20N2O2/c1-10(2)17(3)5-4-11-8-16-13-7-15-14(6-12(11)13)18-9-19-15/h6-8,10,16H,4-5,9H2,1-3H3 |
| Stdinchikey: | OZKGXOZBACDFIQ-UHFFFAOYSA-N |
5,6-MDO-MiPT, or 5,6-methylenedioxy-N-methyl-N-isopropyltryptamine, is a lesser-known psychedelic drug. It is the 5,6-methylenedioxy analog of MiPT. 5,6-MDO-MiPT was first synthesized by Alexander Shulgin. In his book TiHKAL (Tryptamines I Have Known and Loved), 5,6-MDO-MiPT produces slight paresthesia at low doses. Very little data exists about the pharmacological properties, metabolism, and toxicity of 5,6-MDO-MiPT.