| Drug Name: | 5,6-MDO-DiPT |
| Cas Number: | 9P8WPL88C4 |
| Unii: | 9P8WPL88C4 |
| Pubchem: | 13141004 |
| Chemspiderid: | 10524336 |
| Chembl: | 368261 |
| Synonyms: | 5,6-Methylenedioxy-N,N-diisopropyltryptamine |
| Iupac Name: | N-[2-(5H-[1,3]dioxolo[4,5-f]indol-7-yl)ethyl]-N-propan-2-ylpropan-2-amine |
| C: | 17 |
| H: | 24 |
| N: | 2 |
| O: | 2 |
| Smiles: | CC(C)N(CCC1=CNC2=CC3=C(C=C21)OCO3)C(C)C |
| Stdinchi: | 1S/C17H24N2O2/c1-11(2)19(12(3)4)6-5-13-9-18-15-8-17-16(7-14(13)15)20-10-21-17/h7-9,11-12,18H,5-6,10H2,1-4H3 |
| Stdinchikey: | MAICYUOZXYUWMJ-UHFFFAOYSA-N |
5,6-MDO-DiPT, or 5,6-methylenedioxy-N,N-diisopropyltryptamine, is a lesser-known psychedelic drug. It is the 5,6-methylenedioxy analog of DiPT. 5,6-MDO-DiPT was first synthesized by Alexander Shulgin. It is mentioned in his book TiHKAL (Tryptamines I Have Known and Loved), but 5,6-MDO-DiPT was never tested to determine what effects it produces, if any. Very little data exists about the pharmacological properties, metabolism, and toxicity of 5,6-MDO-DiPT.