| Drug Name: | 5,6-MDO-DMT |
| Cas Number: | 82173-81-7 |
| Unii: | QPJ5N6RF24 |
| Pubchem: | 13140993 |
| Chemspiderid: | 10524352 |
| Chembl: | 283686 |
| Iupac Name: | 2-(5H-[1,3]dioxolo[4,5-f]indol-7-yl)-N,N-dimethylethanamine |
| C: | 13 |
| H: | 16 |
| N: | 2 |
| O: | 2 |
| Smiles: | CN(C)CCC1=CNC2=CC3=C(C=C21)OCO3 |
| Stdinchi: | 1S/C13H16N2O2/c1-15(2)4-3-9-7-14-11-6-13-12(5-10(9)11)16-8-17-13/h5-7,14H,3-4,8H2,1-2H3 |
| Stdinchikey: | QHEIGHVZMWJQHB-UHFFFAOYSA-N |
5,6-MDO-DMT, or 5,6-methylenedioxy-N,N-dimethyltryptamine, is a lesser-known psychedelic drug. It is the 5,6-methylenedioxy analog of DMT. 5,6-MDO-DMT was first synthesized by Alexander Shulgin. In his book TiHKAL (Tryptamines I Have Known and Loved), 5,6-MDO-DMT produces no noticeable psychoactive effects, although it was only tested up to a dose of 5 mg. Very little data exists about the pharmacological properties, metabolism, and toxicity of 5,6-MDO-DMT.